1-(4-chlorophenyl)-3-hydroxy-4,5-bis(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
1-(4-chlorophenyl)-3-hydroxy-4,5-bis(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one
1-(4-chlorophenyl)-3-hydroxy-4,5-bis(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | F455-0338 |
| Compound Name: | 1-(4-chlorophenyl)-3-hydroxy-4,5-bis(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 389.88 |
| Molecular Formula: | C24 H20 Cl N O2 |
| Smiles: | Cc1ccc(cc1)C1C(=C(C(N1c1ccc(cc1)[Cl])=O)O)c1ccc(C)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7369 |
| logD: | 5.7367 |
| logSw: | -6.0796 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.4767 |
| InChI Key: | FAORQNYMYQYHLS-JOCHJYFZSA-N |