5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-{[4-(methylsulfanyl)phenyl]methyl}-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-{[4-(methylsulfanyl)phenyl]methyl}-1,5-dihydro-2H-pyrrol-2-one
5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-{[4-(methylsulfanyl)phenyl]methyl}-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | F455-0566 |
| Compound Name: | 5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-{[4-(methylsulfanyl)phenyl]methyl}-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 451.97 |
| Molecular Formula: | C25 H22 Cl N O3 S |
| Smiles: | COc1ccc(cc1)C1C(c2ccc(cc2)[Cl])N(Cc2ccc(cc2)SC)C(C=1O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6176 |
| logD: | 5.617 |
| logSw: | -5.9728 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.632 |
| InChI Key: | DIDHMJCHMJGXRE-HSZRJFAPSA-N |