1-benzyl-4-(4-fluorophenyl)-3-hydroxy-5-phenyl-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
1-benzyl-4-(4-fluorophenyl)-3-hydroxy-5-phenyl-1,5-dihydro-2H-pyrrol-2-one
1-benzyl-4-(4-fluorophenyl)-3-hydroxy-5-phenyl-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | F455-0765 |
| Compound Name: | 1-benzyl-4-(4-fluorophenyl)-3-hydroxy-5-phenyl-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 359.4 |
| Molecular Formula: | C23 H18 F N O2 |
| Smiles: | C(c1ccccc1)N1C(C(=C(C1=O)O)c1ccc(cc1)F)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3546 |
| logD: | 4.354 |
| logSw: | -4.412 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.0882 |
| InChI Key: | HJIWNLKTARJLST-OAQYLSRUSA-N |