1-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-4-(2-phenylethyl)[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one
					Chemical Structure Depiction of
1-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-4-(2-phenylethyl)[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one
			1-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-4-(2-phenylethyl)[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one
Compound characteristics
| Compound ID: | F458-0130 | 
| Compound Name: | 1-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-4-(2-phenylethyl)[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one | 
| Molecular Weight: | 464.95 | 
| Molecular Formula: | C24 H18 Cl F N4 O S | 
| Smiles: | C(CN1C(c2ccccc2n2c1nnc2SCc1ccc(cc1[Cl])F)=O)c1ccccc1 | 
| Stereo: | ACHIRAL | 
| logP: | 5.4957 | 
| logD: | 5.4957 | 
| logSw: | -5.9163 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 39.29 | 
| InChI Key: | XJTURSIOGINZAO-UHFFFAOYSA-N | 
 
				 
				