7-chloro-1-{[(4-ethenylphenyl)methyl]sulfanyl}-4-{3-[(propan-2-yl)oxy]propyl}[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one
					Chemical Structure Depiction of
7-chloro-1-{[(4-ethenylphenyl)methyl]sulfanyl}-4-{3-[(propan-2-yl)oxy]propyl}[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one
			7-chloro-1-{[(4-ethenylphenyl)methyl]sulfanyl}-4-{3-[(propan-2-yl)oxy]propyl}[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one
Compound characteristics
| Compound ID: | F458-0435 | 
| Compound Name: | 7-chloro-1-{[(4-ethenylphenyl)methyl]sulfanyl}-4-{3-[(propan-2-yl)oxy]propyl}[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one | 
| Molecular Weight: | 469 | 
| Molecular Formula: | C24 H25 Cl N4 O2 S | 
| Smiles: | CC(C)OCCCN1C(c2cc(ccc2n2c1nnc2SCc1ccc(C=C)cc1)[Cl])=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.7877 | 
| logD: | 4.7877 | 
| logSw: | -4.8663 | 
| Hydrogen bond acceptors count: | 6 | 
| Polar surface area: | 46.763 | 
| InChI Key: | MXOASQKAEBYMJJ-UHFFFAOYSA-N | 
 
				 
				