ethyl 4-{2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy}-2-phenylquinoline-6-carboxylate
Chemical Structure Depiction of
ethyl 4-{2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy}-2-phenylquinoline-6-carboxylate
ethyl 4-{2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy}-2-phenylquinoline-6-carboxylate
Compound characteristics
| Compound ID: | F460-0531 |
| Compound Name: | ethyl 4-{2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy}-2-phenylquinoline-6-carboxylate |
| Molecular Weight: | 494.47 |
| Molecular Formula: | C27 H21 F3 N2 O4 |
| Smiles: | CCOC(c1ccc2c(c1)c(cc(c1ccccc1)n2)OCC(Nc1cccc(c1)C(F)(F)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.1064 |
| logD: | 7.1058 |
| logSw: | -5.8907 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.515 |
| InChI Key: | QYEPJMLGRJWBLR-UHFFFAOYSA-N |