2-{3-[(4-chlorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}-N-(5-fluoro-2-methylphenyl)acetamide
Chemical Structure Depiction of
2-{3-[(4-chlorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}-N-(5-fluoro-2-methylphenyl)acetamide
2-{3-[(4-chlorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}-N-(5-fluoro-2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | F462-0244 |
| Compound Name: | 2-{3-[(4-chlorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}-N-(5-fluoro-2-methylphenyl)acetamide |
| Molecular Weight: | 453.86 |
| Molecular Formula: | C22 H17 Cl F N5 O3 |
| Smiles: | Cc1ccc(cc1NC(CN1C(N(Cc2ccc(cc2)[Cl])C(c2c1nccn2)=O)=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 3.2513 |
| logD: | 3.2511 |
| logSw: | -3.432 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.958 |
| InChI Key: | ZZBMJRXXMSPQJK-UHFFFAOYSA-N |