N-cyclohexyl-2-{3-[(4-fluorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-cyclohexyl-2-{3-[(4-fluorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
N-cyclohexyl-2-{3-[(4-fluorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | F462-0363 |
| Compound Name: | N-cyclohexyl-2-{3-[(4-fluorophenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide |
| Molecular Weight: | 411.43 |
| Molecular Formula: | C21 H22 F N5 O3 |
| Smiles: | C1CCC(CC1)NC(CN1C(N(Cc2ccc(cc2)F)C(c2c1nccn2)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5623 |
| logD: | 2.5623 |
| logSw: | -2.7583 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.703 |
| InChI Key: | KEYLKJNYEAWPOX-UHFFFAOYSA-N |