N-benzyl-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-benzyl-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
N-benzyl-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | F462-0645 |
| Compound Name: | N-benzyl-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide |
| Molecular Weight: | 431.45 |
| Molecular Formula: | C23 H21 N5 O4 |
| Smiles: | COc1ccc(CN2C(c3c(nccn3)N(CC(NCc3ccccc3)=O)C2=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.2944 |
| logD: | 2.2944 |
| logSw: | -2.5781 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 83.522 |
| InChI Key: | UIHCWZPERWFELT-UHFFFAOYSA-N |