N-[(furan-2-yl)methyl]-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
N-[(furan-2-yl)methyl]-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | F462-0658 |
| Compound Name: | N-[(furan-2-yl)methyl]-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide |
| Molecular Weight: | 421.41 |
| Molecular Formula: | C21 H19 N5 O5 |
| Smiles: | COc1ccc(CN2C(c3c(nccn3)N(CC(NCc3ccco3)=O)C2=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.045 |
| logD: | 2.045 |
| logSw: | -2.5212 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 91.271 |
| InChI Key: | RLGLGGIGWKWXAS-UHFFFAOYSA-N |