3-benzyl-1-[(2,5-dimethylphenyl)methyl]pteridine-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-benzyl-1-[(2,5-dimethylphenyl)methyl]pteridine-2,4(1H,3H)-dione
3-benzyl-1-[(2,5-dimethylphenyl)methyl]pteridine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | F462-0977 |
| Compound Name: | 3-benzyl-1-[(2,5-dimethylphenyl)methyl]pteridine-2,4(1H,3H)-dione |
| Molecular Weight: | 372.43 |
| Molecular Formula: | C22 H20 N4 O2 |
| Smiles: | Cc1ccc(C)c(CN2C(N(Cc3ccccc3)C(c3c2nccn3)=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.3744 |
| logD: | 4.3744 |
| logSw: | -4.3073 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 51.507 |
| InChI Key: | CONCJCDATLHCOS-UHFFFAOYSA-N |