1-benzyl-3-[(4-fluorophenyl)methyl]pteridine-2,4(1H,3H)-dione
Chemical Structure Depiction of
1-benzyl-3-[(4-fluorophenyl)methyl]pteridine-2,4(1H,3H)-dione
1-benzyl-3-[(4-fluorophenyl)methyl]pteridine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | F462-1027 |
| Compound Name: | 1-benzyl-3-[(4-fluorophenyl)methyl]pteridine-2,4(1H,3H)-dione |
| Molecular Weight: | 362.36 |
| Molecular Formula: | C20 H15 F N4 O2 |
| Smiles: | C(c1ccc(cc1)F)N1C(c2c(nccn2)N(Cc2ccccc2)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3574 |
| logD: | 3.3574 |
| logSw: | -3.3338 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 51.507 |
| InChI Key: | PUCULODCKSMCDF-UHFFFAOYSA-N |