2-(9-chloro-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-(9-chloro-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide
2-(9-chloro-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | F464-0353 |
| Compound Name: | 2-(9-chloro-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 437.83 |
| Molecular Formula: | C19 H11 Cl F3 N3 O2 S |
| Smiles: | C(C(Nc1cccc(c1)C(F)(F)F)=O)N1C=Nc2c3c(cccc3sc2C1=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.8401 |
| logD: | 4.8398 |
| logSw: | -5.0718 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.983 |
| InChI Key: | HKPIBOITVZIVBD-UHFFFAOYSA-N |