N-(2-chlorophenyl)-2-(9-fluoro-2-methyl-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
Chemical Structure Depiction of
N-(2-chlorophenyl)-2-(9-fluoro-2-methyl-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
N-(2-chlorophenyl)-2-(9-fluoro-2-methyl-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
Compound characteristics
| Compound ID: | F464-0501 |
| Compound Name: | N-(2-chlorophenyl)-2-(9-fluoro-2-methyl-4-oxo[1]benzothieno[3,2-d]pyrimidin-3(4H)-yl)acetamide |
| Molecular Weight: | 401.84 |
| Molecular Formula: | C19 H13 Cl F N3 O2 S |
| Smiles: | CC1=Nc2c3c(cccc3sc2C(N1CC(Nc1ccccc1[Cl])=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 3.7331 |
| logD: | 3.7329 |
| logSw: | -4.0306 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.332 |
| InChI Key: | NDRXFOJUIXFKLH-UHFFFAOYSA-N |