2-{[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl}-N-[4-(diethylamino)-2-methylphenyl]acetamide
Chemical Structure Depiction of
2-{[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl}-N-[4-(diethylamino)-2-methylphenyl]acetamide
2-{[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl}-N-[4-(diethylamino)-2-methylphenyl]acetamide
Compound characteristics
| Compound ID: | F465-0246 |
| Compound Name: | 2-{[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl}-N-[4-(diethylamino)-2-methylphenyl]acetamide |
| Molecular Weight: | 474.42 |
| Molecular Formula: | C22 H24 Br N3 O2 S |
| Smiles: | CCN(CC)c1ccc(c(C)c1)NC(CSc1ncc(c2ccc(cc2)[Br])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5894 |
| logD: | 5.3801 |
| logSw: | -5.2303 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.46 |
| InChI Key: | CDUVDSWUZZWVEA-UHFFFAOYSA-N |