N-(3-chloro-4-methoxyphenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide
N-(3-chloro-4-methoxyphenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | F465-0303 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 392.83 |
| Molecular Formula: | C18 H14 Cl F N2 O3 S |
| Smiles: | COc1ccc(cc1[Cl])NC(CSc1ncc(c2ccc(cc2)F)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.518 |
| logD: | 4.5177 |
| logSw: | -4.6274 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.052 |
| InChI Key: | KKOJRBYBGAVSJC-UHFFFAOYSA-N |