N-(4-bromophenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(4-bromophenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide
N-(4-bromophenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | F465-0344 |
| Compound Name: | N-(4-bromophenyl)-2-{[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 407.26 |
| Molecular Formula: | C17 H12 Br F N2 O2 S |
| Smiles: | C(C(Nc1ccc(cc1)[Br])=O)Sc1ncc(c2ccc(cc2)F)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.8413 |
| logD: | 4.8412 |
| logSw: | -4.761 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.421 |
| InChI Key: | RUSFCEYMJVFIAZ-UHFFFAOYSA-N |