2-{[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide
Chemical Structure Depiction of
2-{[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide
2-{[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | F465-0632 |
| Compound Name: | 2-{[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide |
| Molecular Weight: | 352.45 |
| Molecular Formula: | C20 H20 N2 O2 S |
| Smiles: | Cc1ccc(cc1C)c1cnc(o1)SCC(Nc1ccccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6639 |
| logD: | 4.6639 |
| logSw: | -4.2424 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.723 |
| InChI Key: | SDBJJFXRBKSHSR-UHFFFAOYSA-N |