N-[(2H-1,3-benzodioxol-5-yl)methyl]-4-ethoxy-2-(3-methoxyphenyl)quinoline-6-carboxamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-4-ethoxy-2-(3-methoxyphenyl)quinoline-6-carboxamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-4-ethoxy-2-(3-methoxyphenyl)quinoline-6-carboxamide
Compound characteristics
| Compound ID: | F473-0620 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-4-ethoxy-2-(3-methoxyphenyl)quinoline-6-carboxamide |
| Molecular Weight: | 456.5 |
| Molecular Formula: | C27 H24 N2 O5 |
| Smiles: | CCOc1cc(c2cccc(c2)OC)nc2ccc(cc12)C(NCc1ccc2c(c1)OCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3893 |
| logD: | 5.3864 |
| logSw: | -5.6003 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.58 |
| InChI Key: | KETSYGGOPMTRGR-UHFFFAOYSA-N |