ethyl 6-chloro-4-{[(4-methylphenyl)methyl]amino}-2-oxo-1,2-dihydroquinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 6-chloro-4-{[(4-methylphenyl)methyl]amino}-2-oxo-1,2-dihydroquinoline-3-carboxylate
ethyl 6-chloro-4-{[(4-methylphenyl)methyl]amino}-2-oxo-1,2-dihydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | F474-2776 |
| Compound Name: | ethyl 6-chloro-4-{[(4-methylphenyl)methyl]amino}-2-oxo-1,2-dihydroquinoline-3-carboxylate |
| Molecular Weight: | 370.83 |
| Molecular Formula: | C20 H19 Cl N2 O3 |
| Smiles: | CCOC(C1=C(c2cc(ccc2NC1=O)[Cl])NCc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1102 |
| logD: | 4.0526 |
| logSw: | -4.4433 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.303 |
| InChI Key: | BPVDEDCKCBXQMU-UHFFFAOYSA-N |