8-methyl-3-phenyl-N-{3-[(propan-2-yl)oxy]propyl}thieno[3,2-c]quinoline-2-carboxamide
Chemical Structure Depiction of
8-methyl-3-phenyl-N-{3-[(propan-2-yl)oxy]propyl}thieno[3,2-c]quinoline-2-carboxamide
8-methyl-3-phenyl-N-{3-[(propan-2-yl)oxy]propyl}thieno[3,2-c]quinoline-2-carboxamide
Compound characteristics
| Compound ID: | F477-2971 |
| Compound Name: | 8-methyl-3-phenyl-N-{3-[(propan-2-yl)oxy]propyl}thieno[3,2-c]quinoline-2-carboxamide |
| Molecular Weight: | 418.56 |
| Molecular Formula: | C25 H26 N2 O2 S |
| Smiles: | CC(C)OCCCNC(c1c(c2ccccc2)c2cnc3ccc(C)cc3c2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7794 |
| logD: | 5.7793 |
| logSw: | -5.3466 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.293 |
| InChI Key: | XIHLIDQEADHQOF-UHFFFAOYSA-N |