2,4,5-trimethyl-N-[3-oxo-3-(piperazin-1-yl)propyl]-N-(2-phenylpropyl)benzene-1-sulfonamide--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
2,4,5-trimethyl-N-[3-oxo-3-(piperazin-1-yl)propyl]-N-(2-phenylpropyl)benzene-1-sulfonamide--trifluoroacetic acid (1/1)
2,4,5-trimethyl-N-[3-oxo-3-(piperazin-1-yl)propyl]-N-(2-phenylpropyl)benzene-1-sulfonamide--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F482-0746 |
| Compound Name: | 2,4,5-trimethyl-N-[3-oxo-3-(piperazin-1-yl)propyl]-N-(2-phenylpropyl)benzene-1-sulfonamide--trifluoroacetic acid (1/1) |
| Molecular Weight: | 571.66 |
| Molecular Formula: | C25 H35 N3 O3 S |
| Salt: | CF3COOH |
| Smiles: | CC(CN(CCC(N1CCNCC1)=O)S(c1cc(C)c(C)cc1C)(=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.958 |
| logD: | 3.13 |
| logSw: | -3.9242 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.674 |
| InChI Key: | QLZZUMSKPYZRGU-QFIPXVFZSA-N |