2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzene-1-sulfonamide--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzene-1-sulfonamide--trifluoroacetic acid (1/1)
2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzene-1-sulfonamide--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F482-1097 |
| Compound Name: | 2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzene-1-sulfonamide--trifluoroacetic acid (1/1) |
| Molecular Weight: | 565.65 |
| Molecular Formula: | C22 H37 N5 O3 S |
| Salt: | CF3COOH |
| Smiles: | Cc1ccccc1S(N(CCCN1CCN(C)CC1)CCC(N1CCNCC1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | -0.0582 |
| logD: | -0.8861 |
| logSw: | -2.1098 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.111 |
| InChI Key: | JTJUODKKJOIDRI-UHFFFAOYSA-N |