N-[4-({2-[2-(4-fluorophenyl)-1H-benzimidazol-1-yl]ethyl}sulfamoyl)phenyl]acetamide
Chemical Structure Depiction of
N-[4-({2-[2-(4-fluorophenyl)-1H-benzimidazol-1-yl]ethyl}sulfamoyl)phenyl]acetamide
N-[4-({2-[2-(4-fluorophenyl)-1H-benzimidazol-1-yl]ethyl}sulfamoyl)phenyl]acetamide
Compound characteristics
| Compound ID: | F485-0094 |
| Compound Name: | N-[4-({2-[2-(4-fluorophenyl)-1H-benzimidazol-1-yl]ethyl}sulfamoyl)phenyl]acetamide |
| Molecular Weight: | 452.51 |
| Molecular Formula: | C23 H21 F N4 O3 S |
| Smiles: | CC(Nc1ccc(cc1)S(NCCn1c2ccccc2nc1c1ccc(cc1)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2764 |
| logD: | 4.2753 |
| logSw: | -4.1545 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.007 |
| InChI Key: | TXGYEXASGMNFGF-UHFFFAOYSA-N |