3,4-dimethyl-N-[2-(2-methyl-1H-benzimidazol-1-yl)ethyl]benzene-1-sulfonamide
Chemical Structure Depiction of
3,4-dimethyl-N-[2-(2-methyl-1H-benzimidazol-1-yl)ethyl]benzene-1-sulfonamide
3,4-dimethyl-N-[2-(2-methyl-1H-benzimidazol-1-yl)ethyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F485-0215 |
| Compound Name: | 3,4-dimethyl-N-[2-(2-methyl-1H-benzimidazol-1-yl)ethyl]benzene-1-sulfonamide |
| Molecular Weight: | 343.45 |
| Molecular Formula: | C18 H21 N3 O2 S |
| Smiles: | Cc1ccc(cc1C)S(NCCn1c2ccccc2nc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0402 |
| logD: | 4.014 |
| logSw: | -3.9994 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.794 |
| InChI Key: | SCBBXYUUWGGKQW-UHFFFAOYSA-N |