2,5-dimethyl-N-{2-[2-(2-phenylethyl)-1H-benzimidazol-1-yl]ethyl}benzene-1-sulfonamide
Chemical Structure Depiction of
2,5-dimethyl-N-{2-[2-(2-phenylethyl)-1H-benzimidazol-1-yl]ethyl}benzene-1-sulfonamide
2,5-dimethyl-N-{2-[2-(2-phenylethyl)-1H-benzimidazol-1-yl]ethyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F485-0456 |
| Compound Name: | 2,5-dimethyl-N-{2-[2-(2-phenylethyl)-1H-benzimidazol-1-yl]ethyl}benzene-1-sulfonamide |
| Molecular Weight: | 433.57 |
| Molecular Formula: | C25 H27 N3 O2 S |
| Smiles: | Cc1ccc(C)c(c1)S(NCCn1c2ccccc2nc1CCc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0262 |
| logD: | 6.0037 |
| logSw: | -5.5459 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.721 |
| InChI Key: | IYLVLGMJKMAPNM-UHFFFAOYSA-N |