3-[2-(4-fluorophenyl)-4-methyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(oxolan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
					Chemical Structure Depiction of
3-[2-(4-fluorophenyl)-4-methyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(oxolan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
			3-[2-(4-fluorophenyl)-4-methyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(oxolan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | F486-0665 | 
| Compound Name: | 3-[2-(4-fluorophenyl)-4-methyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(oxolan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide | 
| Molecular Weight: | 416.37 | 
| Molecular Formula: | C18 H17 F N6 O5 | 
| Smiles: | CN1C(C(c2nc(C(NCC3CCCO3)=O)on2)=NN(C1=O)c1ccc(cc1)F)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 0.9201 | 
| logD: | 0.92 | 
| logSw: | -1.8546 | 
| Hydrogen bond acceptors count: | 11 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 107.027 | 
| InChI Key: | KLDLUZIFJDZFAK-GFCCVEGCSA-N | 
 
				 
				