3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | F486-0921 |
| Compound Name: | 3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 438.46 |
| Molecular Formula: | C20 H18 N6 O4 S |
| Smiles: | CCN1C(C(c2nc(C(NCc3cccs3)=O)on2)=NN(C1=O)c1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9574 |
| logD: | 2.9573 |
| logSw: | -3.309 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 99.35 |
| InChI Key: | XHSKGMINNVAZIP-UHFFFAOYSA-N |