5-{[(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)sulfanyl]methyl}-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
5-{[(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)sulfanyl]methyl}-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide
5-{[(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)sulfanyl]methyl}-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | F499-0029 |
| Compound Name: | 5-{[(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)sulfanyl]methyl}-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 409.53 |
| Molecular Formula: | C17 H23 N5 O3 S2 |
| Smiles: | CN(C)CCNC(CSCc1nnc(C(Nc2ccc(cc2)OC)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.393 |
| logD: | 0.2473 |
| logSw: | -2.2042 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 83.051 |
| InChI Key: | ZRYJZKPOQIINEK-UHFFFAOYSA-N |