N-(4-fluorophenyl)-5-[({2-oxo-2-[(propan-2-yl)amino]ethyl}sulfanyl)methyl]-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-5-[({2-oxo-2-[(propan-2-yl)amino]ethyl}sulfanyl)methyl]-1,3,4-thiadiazole-2-carboxamide
N-(4-fluorophenyl)-5-[({2-oxo-2-[(propan-2-yl)amino]ethyl}sulfanyl)methyl]-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | F499-0568 |
| Compound Name: | N-(4-fluorophenyl)-5-[({2-oxo-2-[(propan-2-yl)amino]ethyl}sulfanyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 368.45 |
| Molecular Formula: | C15 H17 F N4 O2 S2 |
| Smiles: | CC(C)NC(CSCc1nnc(C(Nc2ccc(cc2)F)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.341 |
| logD: | 2.3383 |
| logSw: | -2.8983 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.775 |
| InChI Key: | WVOBQRVPKOEMRZ-UHFFFAOYSA-N |