5-[({2-[(butan-2-yl)amino]-2-oxoethyl}sulfanyl)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
5-[({2-[(butan-2-yl)amino]-2-oxoethyl}sulfanyl)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide
5-[({2-[(butan-2-yl)amino]-2-oxoethyl}sulfanyl)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | F499-0694 |
| Compound Name: | 5-[({2-[(butan-2-yl)amino]-2-oxoethyl}sulfanyl)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 364.49 |
| Molecular Formula: | C16 H20 N4 O2 S2 |
| Smiles: | CCC(C)NC(CSCc1nnc(C(Nc2ccccc2)=O)s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5078 |
| logD: | 2.5078 |
| logSw: | -2.8424 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.242 |
| InChI Key: | LQXIZGAVDCUQAO-NSHDSACASA-N |