5-(4-{[2-(4-methylphenyl)ethyl]amino}-4-oxobutyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
5-(4-{[2-(4-methylphenyl)ethyl]amino}-4-oxobutyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
5-(4-{[2-(4-methylphenyl)ethyl]amino}-4-oxobutyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | F501-0653 |
| Compound Name: | 5-(4-{[2-(4-methylphenyl)ethyl]amino}-4-oxobutyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 408.52 |
| Molecular Formula: | C22 H24 N4 O2 S |
| Smiles: | Cc1ccc(CCNC(CCCc2nnc(C(Nc3ccccc3)=O)s2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.8361 |
| logD: | 2.836 |
| logSw: | -3.5233 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.37 |
| InChI Key: | XCYVDQYRJUNERO-UHFFFAOYSA-N |