3-{3-[2-(4-chlorophenyl)-4-ethyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl}-N-cyclohexylpropanamide
Chemical Structure Depiction of
3-{3-[2-(4-chlorophenyl)-4-ethyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl}-N-cyclohexylpropanamide
3-{3-[2-(4-chlorophenyl)-4-ethyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl}-N-cyclohexylpropanamide
Compound characteristics
| Compound ID: | F506-0999 |
| Compound Name: | 3-{3-[2-(4-chlorophenyl)-4-ethyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl}-N-cyclohexylpropanamide |
| Molecular Weight: | 472.93 |
| Molecular Formula: | C22 H25 Cl N6 O4 |
| Smiles: | CCN1C(C(c2nc(CCC(NC3CCCCC3)=O)on2)=NN(C1=O)c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.6436 |
| logD: | 3.6436 |
| logSw: | -3.9755 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 97.509 |
| InChI Key: | XMOARJDKXAPKAX-UHFFFAOYSA-N |