2-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(3-phenylpropyl)acetamide
Chemical Structure Depiction of
2-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(3-phenylpropyl)acetamide
2-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(3-phenylpropyl)acetamide
Compound characteristics
| Compound ID: | F512-0198 |
| Compound Name: | 2-(4-benzyl-2,3-dioxopiperazin-1-yl)-N-(3-phenylpropyl)acetamide |
| Molecular Weight: | 379.46 |
| Molecular Formula: | C22 H25 N3 O3 |
| Smiles: | [H]C(C(NCCCc1ccccc1)=O)N1CCN(Cc2ccccc2)C(C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1697 |
| logD: | 2.1697 |
| logSw: | -2.6232 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.596 |
| InChI Key: | WUBBZFWZZPGZQF-UHFFFAOYSA-N |