4-{[6-(4-fluorophenyl)pyridazin-3-yl]amino}-N-[(4-methylphenyl)methyl]benzamide
Chemical Structure Depiction of
4-{[6-(4-fluorophenyl)pyridazin-3-yl]amino}-N-[(4-methylphenyl)methyl]benzamide
4-{[6-(4-fluorophenyl)pyridazin-3-yl]amino}-N-[(4-methylphenyl)methyl]benzamide
Compound characteristics
| Compound ID: | F516-0193 |
| Compound Name: | 4-{[6-(4-fluorophenyl)pyridazin-3-yl]amino}-N-[(4-methylphenyl)methyl]benzamide |
| Molecular Weight: | 412.47 |
| Molecular Formula: | C25 H21 F N4 O |
| Smiles: | Cc1ccc(CNC(c2ccc(cc2)Nc2ccc(c3ccc(cc3)F)nn2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0525 |
| logD: | 5.0523 |
| logSw: | -4.6387 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.603 |
| InChI Key: | HYORRBTVUSPBIB-UHFFFAOYSA-N |