4-methoxy-N-[3-(1H-tetrazol-1-yl)phenyl]benzamide
Chemical Structure Depiction of
4-methoxy-N-[3-(1H-tetrazol-1-yl)phenyl]benzamide
4-methoxy-N-[3-(1H-tetrazol-1-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | F517-0027 |
| Compound Name: | 4-methoxy-N-[3-(1H-tetrazol-1-yl)phenyl]benzamide |
| Molecular Weight: | 295.3 |
| Molecular Formula: | C15 H13 N5 O2 |
| Smiles: | COc1ccc(cc1)C(Nc1cccc(c1)n1cnnn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3648 |
| logD: | 2.3648 |
| logSw: | -3.1136 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.639 |
| InChI Key: | IFPURLLJPPDRAO-UHFFFAOYSA-N |