N-{2-[(5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-2-ethoxybenzamide
Chemical Structure Depiction of
N-{2-[(5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-2-ethoxybenzamide
N-{2-[(5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-2-ethoxybenzamide
Compound characteristics
| Compound ID: | F518-0073 |
| Compound Name: | N-{2-[(5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-2-ethoxybenzamide |
| Molecular Weight: | 419.5 |
| Molecular Formula: | C22 H21 N5 O2 S |
| Smiles: | CCOc1ccccc1C(Nc1ccccc1Sc1c(C)c(C)nc2ncnn12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9817 |
| logD: | 3.9816 |
| logSw: | -4.1552 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.899 |
| InChI Key: | OAMWVOYFGJEUDC-UHFFFAOYSA-N |