N-{2-[(6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-3,4-dimethoxybenzamide
Chemical Structure Depiction of
N-{2-[(6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-3,4-dimethoxybenzamide
N-{2-[(6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-3,4-dimethoxybenzamide
Compound characteristics
| Compound ID: | F518-0139 |
| Compound Name: | N-{2-[(6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-3,4-dimethoxybenzamide |
| Molecular Weight: | 449.53 |
| Molecular Formula: | C23 H23 N5 O3 S |
| Smiles: | CCc1c(C)nc2ncnn2c1Sc1ccccc1NC(c1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8256 |
| logD: | 3.8255 |
| logSw: | -4.1444 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.95 |
| InChI Key: | FBMACPPMIPEIDG-UHFFFAOYSA-N |