N-{2-[(5,6-dimethyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-4-methoxybenzamide
Chemical Structure Depiction of
N-{2-[(5,6-dimethyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-4-methoxybenzamide
N-{2-[(5,6-dimethyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-4-methoxybenzamide
Compound characteristics
| Compound ID: | F518-0280 |
| Compound Name: | N-{2-[(5,6-dimethyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}-4-methoxybenzamide |
| Molecular Weight: | 481.58 |
| Molecular Formula: | C27 H23 N5 O2 S |
| Smiles: | Cc1c(C)nc2nc(c3ccccc3)nn2c1Sc1ccccc1NC(c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6361 |
| logD: | 5.6359 |
| logSw: | -5.6447 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.02 |
| InChI Key: | RRPXJMOEVYEPAP-UHFFFAOYSA-N |