3-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione
3-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | F521-0148 |
| Compound Name: | 3-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Weight: | 387.44 |
| Molecular Formula: | C23 H21 N3 O3 |
| Smiles: | Cc1ccc(CN2C(N(Cc3ccc(cc3)OC)C(c3c2cccn3)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.0016 |
| logD: | 4.0016 |
| logSw: | -4.1032 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.72 |
| InChI Key: | MFOFMJYEBDOTNK-UHFFFAOYSA-N |