1-(4-cyclohexylpiperazin-1-yl)-2-{4-[1-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]-3,6-dihydropyridin-1(2H)-yl}ethan-1-one
Chemical Structure Depiction of
1-(4-cyclohexylpiperazin-1-yl)-2-{4-[1-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]-3,6-dihydropyridin-1(2H)-yl}ethan-1-one
1-(4-cyclohexylpiperazin-1-yl)-2-{4-[1-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]-3,6-dihydropyridin-1(2H)-yl}ethan-1-one
Compound characteristics
| Compound ID: | F523-0113 |
| Compound Name: | 1-(4-cyclohexylpiperazin-1-yl)-2-{4-[1-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]-3,6-dihydropyridin-1(2H)-yl}ethan-1-one |
| Molecular Weight: | 461.65 |
| Molecular Formula: | C28 H39 N5 O |
| Smiles: | Cc1ccc(cc1C)n1cc(cn1)C1CCN(CC=1)CC(N1CCN(CC1)C1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5101 |
| logD: | 4.3477 |
| logSw: | -4.1391 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.543 |
| InChI Key: | OGUILSKVQPDJMD-UHFFFAOYSA-N |