N-[(4-chlorophenyl)methyl]-N'-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-N'-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea
N-[(4-chlorophenyl)methyl]-N'-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea
Compound characteristics
| Compound ID: | F532-4343 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-N'-[4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
| Molecular Weight: | 382.85 |
| Molecular Formula: | C20 H19 Cl N4 O2 |
| Smiles: | C1CC(C1)c1nc(c2ccc(cc2)NC(NCc2ccc(cc2)[Cl])=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.8132 |
| logD: | 4.8132 |
| logSw: | -5.1412 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.793 |
| InChI Key: | XWBCUQYYAUJMPG-UHFFFAOYSA-N |