2-ethyl-6-[4-(phenoxyacetyl)piperazine-1-sulfonyl]-2H-1,4-benzoxazin-3(4H)-one
Chemical Structure Depiction of
2-ethyl-6-[4-(phenoxyacetyl)piperazine-1-sulfonyl]-2H-1,4-benzoxazin-3(4H)-one
2-ethyl-6-[4-(phenoxyacetyl)piperazine-1-sulfonyl]-2H-1,4-benzoxazin-3(4H)-one
Compound characteristics
| Compound ID: | F537-0423 |
| Compound Name: | 2-ethyl-6-[4-(phenoxyacetyl)piperazine-1-sulfonyl]-2H-1,4-benzoxazin-3(4H)-one |
| Molecular Weight: | 459.52 |
| Molecular Formula: | C22 H25 N3 O6 S |
| Smiles: | CCC1C(Nc2cc(ccc2O1)S(N1CCN(CC1)C(COc1ccccc1)=O)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9173 |
| logD: | 1.9169 |
| logSw: | -2.8447 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 88.18 |
| InChI Key: | UOIVVSJUDHWGPN-LJQANCHMSA-N |