N-{3-[5-(4-cyanophenyl)-1,2,4-oxadiazol-3-yl]phenyl}-N'-phenylurea
Chemical Structure Depiction of
N-{3-[5-(4-cyanophenyl)-1,2,4-oxadiazol-3-yl]phenyl}-N'-phenylurea
N-{3-[5-(4-cyanophenyl)-1,2,4-oxadiazol-3-yl]phenyl}-N'-phenylurea
Compound characteristics
| Compound ID: | F538-0780 |
| Compound Name: | N-{3-[5-(4-cyanophenyl)-1,2,4-oxadiazol-3-yl]phenyl}-N'-phenylurea |
| Molecular Weight: | 381.39 |
| Molecular Formula: | C22 H15 N5 O2 |
| Smiles: | C(c1ccc(cc1)c1nc(c2cccc(c2)NC(Nc2ccccc2)=O)no1)#N |
| Stereo: | ACHIRAL |
| logP: | 5.4552 |
| logD: | 5.4552 |
| logSw: | -5.9927 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 81.003 |
| InChI Key: | ZUGSMMKIFBGNOT-UHFFFAOYSA-N |