(2,3-dihydro-1H-indol-1-yl)[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methanone
Chemical Structure Depiction of
(2,3-dihydro-1H-indol-1-yl)[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methanone
(2,3-dihydro-1H-indol-1-yl)[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methanone
Compound characteristics
| Compound ID: | F545-0061 |
| Compound Name: | (2,3-dihydro-1H-indol-1-yl)[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methanone |
| Molecular Weight: | 305.33 |
| Molecular Formula: | C18 H15 N3 O2 |
| Smiles: | Cc1nc(c2cccc(c2)C(N2CCc3ccccc23)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.3535 |
| logD: | 3.3535 |
| logSw: | -3.5777 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.822 |
| InChI Key: | VBQBINZOZZDRNF-UHFFFAOYSA-N |