(2,3-dihydro-1H-indol-1-yl){6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl}methanone
Chemical Structure Depiction of
(2,3-dihydro-1H-indol-1-yl){6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl}methanone
(2,3-dihydro-1H-indol-1-yl){6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl}methanone
Compound characteristics
| Compound ID: | F548-2140 |
| Compound Name: | (2,3-dihydro-1H-indol-1-yl){6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl}methanone |
| Molecular Weight: | 403.46 |
| Molecular Formula: | C23 H22 F N5 O |
| Smiles: | C1CN(C(c2ccc(nn2)N2CCN(CC2)c2ccccc2F)=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.7635 |
| logD: | 3.7635 |
| logSw: | -4.0124 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 43.535 |
| InChI Key: | JVLPMJCGVYSAMC-UHFFFAOYSA-N |