N-{2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]ethyl}-4-methylbenzamide
Chemical Structure Depiction of
N-{2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]ethyl}-4-methylbenzamide
N-{2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]ethyl}-4-methylbenzamide
Compound characteristics
| Compound ID: | F552-0194 |
| Compound Name: | N-{2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]ethyl}-4-methylbenzamide |
| Molecular Weight: | 367.83 |
| Molecular Formula: | C20 H18 Cl N3 O2 |
| Smiles: | Cc1ccc(cc1)C(NCCN1C(C=CC(c2ccc(cc2)[Cl])=N1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.504 |
| logD: | 3.504 |
| logSw: | -4.0363 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.052 |
| InChI Key: | UCAWIQSXGSFZFX-UHFFFAOYSA-N |