3-{[6-(3-methylphenyl)pyridazin-3-yl]amino}-N-(2-phenylethyl)benzamide
Chemical Structure Depiction of
3-{[6-(3-methylphenyl)pyridazin-3-yl]amino}-N-(2-phenylethyl)benzamide
3-{[6-(3-methylphenyl)pyridazin-3-yl]amino}-N-(2-phenylethyl)benzamide
Compound characteristics
| Compound ID: | F575-0081 |
| Compound Name: | 3-{[6-(3-methylphenyl)pyridazin-3-yl]amino}-N-(2-phenylethyl)benzamide |
| Molecular Weight: | 408.5 |
| Molecular Formula: | C26 H24 N4 O |
| Smiles: | Cc1cccc(c1)c1ccc(Nc2cccc(c2)C(NCCc2ccccc2)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 5.0818 |
| logD: | 5.0815 |
| logSw: | -4.9014 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.444 |
| InChI Key: | DKURPRWNGRFGOQ-UHFFFAOYSA-N |