N-heptyl-3-{[6-(4-methylphenyl)pyridazin-3-yl]amino}benzamide
Chemical Structure Depiction of
N-heptyl-3-{[6-(4-methylphenyl)pyridazin-3-yl]amino}benzamide
N-heptyl-3-{[6-(4-methylphenyl)pyridazin-3-yl]amino}benzamide
Compound characteristics
| Compound ID: | F575-0210 |
| Compound Name: | N-heptyl-3-{[6-(4-methylphenyl)pyridazin-3-yl]amino}benzamide |
| Molecular Weight: | 402.54 |
| Molecular Formula: | C25 H30 N4 O |
| Smiles: | CCCCCCCNC(c1cccc(c1)Nc1ccc(c2ccc(C)cc2)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.5575 |
| logD: | 6.5573 |
| logSw: | -5.5072 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.716 |
| InChI Key: | HBKDOPANPBPYLO-UHFFFAOYSA-N |