1-[6-(4-ethoxyphenyl)-3-(ethylsulfanyl)-10-methyl[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one
Chemical Structure Depiction of
1-[6-(4-ethoxyphenyl)-3-(ethylsulfanyl)-10-methyl[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one
1-[6-(4-ethoxyphenyl)-3-(ethylsulfanyl)-10-methyl[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | F579-1199 |
| Compound Name: | 1-[6-(4-ethoxyphenyl)-3-(ethylsulfanyl)-10-methyl[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one |
| Molecular Weight: | 436.53 |
| Molecular Formula: | C23 H24 N4 O3 S |
| Smiles: | CCOc1ccc(cc1)C1N(C(C)=O)c2ccc(C)cc2c2c(nc(nn2)SCC)O1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4485 |
| logD: | 4.4485 |
| logSw: | -4.4369 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 61.763 |
| InChI Key: | UMMIRQGJGHFVRD-QFIPXVFZSA-N |